C17H20BrFN4O — CID 19478917
(4-bromo-1-ethylpyrazol-5-yl)-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19478917) has the molecular formula C17H20BrFN4O and a molecular weight of 395.28 g/mol. Its IUPAC name is (4-bromo-1-ethylpyrazol-5-yl)-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (4-bromo-1-ethylpyrazol-5-yl)-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19478917 |
| Molecular Formula | C17H20BrFN4O |
| Molecular Weight | 395.28 g/mol |
| Exact Mass | 394.08 |
| IUPAC Name | (4-bromo-1-ethylpyrazol-5-yl)-[4-[(2-fluorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | CCn1ncc(Br)c1C(=O)N1CCN(Cc2ccccc2F)CC1 |
| InChI | InChI=1S/C17H20BrFN4O/c1-2-23-16(14(18)11-20-23)17(24)22-9-7-21(8-10-22)12-13-5-3-4-6-15(13)19/h3-6,11H,2,7-10,12H2,1H3 |
| InChIKey | ZCIAYOMLQGDKSO-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.28 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |