C14H10ClFIN5O — CID 19479942
N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-4-iodo-1H-pyrazole-5-carboxamide (PubChem CID 19479942) has the molecular formula C14H10ClFIN5O and a molecular weight of 445.62 g/mol. Its IUPAC name is N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-4-iodo-1H-pyrazole-5-carboxamide.
| Compound Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-4-iodo-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19479942 |
| Molecular Formula | C14H10ClFIN5O |
| Molecular Weight | 445.62 g/mol |
| Exact Mass | 444.96 |
| IUPAC Name | N-[1-[(2-chloro-4-fluorophenyl)methyl]pyrazol-3-yl]-4-iodo-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2ccc(F)cc2Cl)n1)c1[nH]ncc1I |
| InChI | InChI=1S/C14H10ClFIN5O/c15-10-5-9(16)2-1-8(10)7-22-4-3-12(21-22)19-14(23)13-11(17)6-18-20-13/h1-6H,7H2,(H,18,20)(H,19,21,23) |
| InChIKey | TWWCEXHXSNFXMX-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.62 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|