C7H11N3O — CID 19481451
N,2,5-trimethylpyrazole-3-carboxamide (PubChem CID 19481451) has the molecular formula C7H11N3O and a molecular weight of 153.18 g/mol. Its IUPAC name is N,2,5-trimethylpyrazole-3-carboxamide.
| Compound Name | N,2,5-trimethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19481451 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | N,2,5-trimethylpyrazole-3-carboxamide |
| SMILES | CNC(=O)c1cc(C)nn1C |
| InChI | InChI=1S/C7H11N3O/c1-5-4-6(7(11)8-2)10(3)9-5/h4H,1-3H3,(H,8,11) |
| InChIKey | JPWDDOVHXQWGKK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |