C17H20ClNO2S — CID 19483323
4-[(4-chloro-3-methylphenoxy)methyl]-N-(2-methylpropyl)thiophene-2-carboxamide (PubChem CID 19483323) has the molecular formula C17H20ClNO2S and a molecular weight of 337.87 g/mol. Its IUPAC name is 4-[(4-chloro-3-methylphenoxy)methyl]-N-(2-methylpropyl)thiophene-2-carboxamide.
| Compound Name | 4-[(4-chloro-3-methylphenoxy)methyl]-N-(2-methylpropyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19483323 |
| Molecular Formula | C17H20ClNO2S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 4-[(4-chloro-3-methylphenoxy)methyl]-N-(2-methylpropyl)thiophene-2-carboxamide |
| SMILES | Cc1cc(OCc2csc(C(=O)NCC(C)C)c2)ccc1Cl |
| InChI | InChI=1S/C17H20ClNO2S/c1-11(2)8-19-17(20)16-7-13(10-22-16)9-21-14-4-5-15(18)12(3)6-14/h4-7,10-11H,8-9H2,1-3H3,(H,19,20) |
| InChIKey | FZPFFOSRRAVMFH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |