C24H29NO2S — CID 19483510
N-(1-adamantyl)-4-[(2,4-dimethylphenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19483510) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[(2,4-dimethylphenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(1-adamantyl)-4-[(2,4-dimethylphenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19483510 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | N-(1-adamantyl)-4-[(2,4-dimethylphenoxy)methyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(OCc2csc(C(=O)NC34CC5CC(CC(C5)C3)C4)c2)c(C)c1 |
| InChI | InChI=1S/C24H29NO2S/c1-15-3-4-21(16(2)5-15)27-13-20-9-22(28-14-20)23(26)25-24-10-17-6-18(11-24)8-19(7-17)12-24/h3-5,9,14,17-19H,6-8,10-13H2,1-2H3,(H,25,26) |
| InChIKey | YVZFUUNLTNQRAY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |