C22H23F2NO2S — CID 19469636
N-(1-adamantyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19469636) has the molecular formula C22H23F2NO2S and a molecular weight of 403.49 g/mol. Its IUPAC name is N-(1-adamantyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-(1-adamantyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19469636 |
| Molecular Formula | C22H23F2NO2S |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.14 |
| IUPAC Name | N-(1-adamantyl)-4-[(2,4-difluorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | O=C(NC12CC3CC(CC(C3)C1)C2)c1cc(COc2ccc(F)cc2F)cs1 |
| InChI | InChI=1S/C22H23F2NO2S/c23-17-1-2-19(18(24)7-17)27-11-16-6-20(28-12-16)21(26)25-22-8-13-3-14(9-22)5-15(4-13)10-22/h1-2,6-7,12-15H,3-5,8-11H2,(H,25,26) |
| InChIKey | WNBWMJNAJVJOPN-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |