C13H11F2N3O4 — CID 19485561
2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 19485561) has the molecular formula C13H11F2N3O4 and a molecular weight of 311.24 g/mol. Its IUPAC name is 2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19485561 |
| Molecular Formula | C13H11F2N3O4 |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[2-[4-(difluoromethoxy)anilino]-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | O=C(Cn1nccc1C(=O)O)Nc1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C13H11F2N3O4/c14-13(15)22-9-3-1-8(2-4-9)17-11(19)7-18-10(12(20)21)5-6-16-18/h1-6,13H,7H2,(H,17,19)(H,20,21) |
| InChIKey | YOZVNCDTNNUINF-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |