C13H17N5O3 — CID 19485649
2-[2-[1-(2-ethylpyrazol-3-yl)ethylamino]-2-oxoethyl]pyrazole-3-carboxylic acid (PubChem CID 19485649) has the molecular formula C13H17N5O3 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[2-[1-(2-ethylpyrazol-3-yl)ethylamino]-2-oxoethyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[2-[1-(2-ethylpyrazol-3-yl)ethylamino]-2-oxoethyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19485649 |
| Molecular Formula | C13H17N5O3 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[2-[1-(2-ethylpyrazol-3-yl)ethylamino]-2-oxoethyl]pyrazole-3-carboxylic acid |
| SMILES | CCn1nccc1C(C)NC(=O)Cn1nccc1C(=O)O |
| InChI | InChI=1S/C13H17N5O3/c1-3-17-10(4-6-14-17)9(2)16-12(19)8-18-11(13(20)21)5-7-15-18/h4-7,9H,3,8H2,1-2H3,(H,16,19)(H,20,21) |
| InChIKey | AMORBMYXOFWDCF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |