C12H19N3O4 — CID 19489817
2-[1-(3-ethoxypropylamino)-1-oxopropan-2-yl]pyrazole-3-carboxylic acid (PubChem CID 19489817) has the molecular formula C12H19N3O4 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-[1-(3-ethoxypropylamino)-1-oxopropan-2-yl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[1-(3-ethoxypropylamino)-1-oxopropan-2-yl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19489817 |
| Molecular Formula | C12H19N3O4 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[1-(3-ethoxypropylamino)-1-oxopropan-2-yl]pyrazole-3-carboxylic acid |
| SMILES | CCOCCCNC(=O)C(C)n1nccc1C(=O)O |
| InChI | InChI=1S/C12H19N3O4/c1-3-19-8-4-6-13-11(16)9(2)15-10(12(17)18)5-7-14-15/h5,7,9H,3-4,6,8H2,1-2H3,(H,13,16)(H,17,18) |
| InChIKey | HVEKIGMJJXLEGF-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|