C7H8N2O4 — CID 19489942
2-(1-carboxyethyl)pyrazole-3-carboxylic acid (PubChem CID 19489942) has the molecular formula C7H8N2O4 and a molecular weight of 184.15 g/mol. Its IUPAC name is 2-(1-carboxyethyl)pyrazole-3-carboxylic acid.
| Compound Name | 2-(1-carboxyethyl)pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19489942 |
| Molecular Formula | C7H8N2O4 |
| Molecular Weight | 184.15 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 2-(1-carboxyethyl)pyrazole-3-carboxylic acid |
| SMILES | CC(C(=O)O)n1nccc1C(=O)O |
| InChI | InChI=1S/C7H8N2O4/c1-4(6(10)11)9-5(7(12)13)2-3-8-9/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | NZTMBWVXMNBGHK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.15 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |