C21H20N4O6 — CID 19492193
2-[3-[3-(3,5-dimethylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid (PubChem CID 19492193) has the molecular formula C21H20N4O6 and a molecular weight of 424.41 g/mol. Its IUPAC name is 2-[3-[3-(3,5-dimethylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid.
| Compound Name | 2-[3-[3-(3,5-dimethylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19492193 |
| Molecular Formula | C21H20N4O6 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-[3-[3-(3,5-dimethylphenoxy)-5-nitroanilino]-3-oxopropyl]pyrazole-3-carboxylic acid |
| SMILES | Cc1cc(C)cc(Oc2cc(NC(=O)CCn3nccc3C(=O)O)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C21H20N4O6/c1-13-7-14(2)9-17(8-13)31-18-11-15(10-16(12-18)25(29)30)23-20(26)4-6-24-19(21(27)28)3-5-22-24/h3,5,7-12H,4,6H2,1-2H3,(H,23,26)(H,27,28) |
| InChIKey | MEXBUKHAZMUZOM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 136.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|