C24H26FNO2S — CID 19493248
N-[1-(4-tert-butylphenyl)ethyl]-4-[(3-fluorophenoxy)methyl]thiophene-2-carboxamide (PubChem CID 19493248) has the molecular formula C24H26FNO2S and a molecular weight of 411.54 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-4-[(3-fluorophenoxy)methyl]thiophene-2-carboxamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-4-[(3-fluorophenoxy)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19493248 |
| Molecular Formula | C24H26FNO2S |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-4-[(3-fluorophenoxy)methyl]thiophene-2-carboxamide |
| SMILES | CC(NC(=O)c1cc(COc2cccc(F)c2)cs1)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H26FNO2S/c1-16(18-8-10-19(11-9-18)24(2,3)4)26-23(27)22-12-17(15-29-22)14-28-21-7-5-6-20(25)13-21/h5-13,15-16H,14H2,1-4H3,(H,26,27) |
| InChIKey | NWCDFQOKWGEBQZ-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |