C23H24ClNO2S — CID 19505193
4-[(3-chlorophenoxy)methyl]-N-[1-(4-propan-2-ylphenyl)ethyl]thiophene-2-carboxamide (PubChem CID 19505193) has the molecular formula C23H24ClNO2S and a molecular weight of 413.97 g/mol. Its IUPAC name is 4-[(3-chlorophenoxy)methyl]-N-[1-(4-propan-2-ylphenyl)ethyl]thiophene-2-carboxamide.
| Compound Name | 4-[(3-chlorophenoxy)methyl]-N-[1-(4-propan-2-ylphenyl)ethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19505193 |
| Molecular Formula | C23H24ClNO2S |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.12 |
| IUPAC Name | 4-[(3-chlorophenoxy)methyl]-N-[1-(4-propan-2-ylphenyl)ethyl]thiophene-2-carboxamide |
| SMILES | CC(C)c1ccc(C(C)NC(=O)c2cc(COc3cccc(Cl)c3)cs2)cc1 |
| InChI | InChI=1S/C23H24ClNO2S/c1-15(2)18-7-9-19(10-8-18)16(3)25-23(26)22-11-17(14-28-22)13-27-21-6-4-5-20(24)12-21/h4-12,14-16H,13H2,1-3H3,(H,25,26) |
| InChIKey | AGQGZGGVEFIXLS-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |