C21H21BrN2O4S — CID 19495511
ethyl 2-[[3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19495511) has the molecular formula C21H21BrN2O4S and a molecular weight of 477.38 g/mol. Its IUPAC name is ethyl 2-[[3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19495511 |
| Molecular Formula | C21H21BrN2O4S |
| Molecular Weight | 477.38 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | ethyl 2-[[3-(3-bromophenyl)-4,5-dihydro-1,2-oxazole-5-carbonyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)C2CC(c3cccc(Br)c3)=NO2)sc2c1CCCC2 |
| InChI | InChI=1S/C21H21BrN2O4S/c1-2-27-21(26)18-14-8-3-4-9-17(14)29-20(18)23-19(25)16-11-15(24-28-16)12-6-5-7-13(22)10-12/h5-7,10,16H,2-4,8-9,11H2,1H3,(H,23,25) |
| InChIKey | ZQCWWBDRVJBEFQ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.38 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |