C15H17N3O5S — CID 19496208
4-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)carbamoyl]-1-methylpyrazole-5-carboxylic acid (PubChem CID 19496208) has the molecular formula C15H17N3O5S and a molecular weight of 351.38 g/mol. Its IUPAC name is 4-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)carbamoyl]-1-methylpyrazole-5-carboxylic acid.
| Compound Name | 4-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)carbamoyl]-1-methylpyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 19496208 |
| Molecular Formula | C15H17N3O5S |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 4-[(3-ethoxycarbonyl-5-ethylthiophen-2-yl)carbamoyl]-1-methylpyrazole-5-carboxylic acid |
| SMILES | CCOC(=O)c1cc(CC)sc1NC(=O)c1cnn(C)c1C(=O)O |
| InChI | InChI=1S/C15H17N3O5S/c1-4-8-6-9(15(22)23-5-2)13(24-8)17-12(19)10-7-16-18(3)11(10)14(20)21/h6-7H,4-5H2,1-3H3,(H,17,19)(H,20,21) |
| InChIKey | VZHLBQCPZOLSPA-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |