C17H13N5O3S2 — CID 19496708
N-(4-methyl-1,3-benzothiazol-2-yl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide (PubChem CID 19496708) has the molecular formula C17H13N5O3S2 and a molecular weight of 399.46 g/mol. Its IUPAC name is N-(4-methyl-1,3-benzothiazol-2-yl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide.
| Compound Name | N-(4-methyl-1,3-benzothiazol-2-yl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19496708 |
| Molecular Formula | C17H13N5O3S2 |
| Molecular Weight | 399.46 g/mol |
| Exact Mass | 399.05 |
| IUPAC Name | N-(4-methyl-1,3-benzothiazol-2-yl)-4-[(3-nitropyrazol-1-yl)methyl]thiophene-2-carboxamide |
| SMILES | Cc1cccc2sc(NC(=O)c3cc(Cn4ccc([N+](=O)[O-])n4)cs3)nc12 |
| InChI | InChI=1S/C17H13N5O3S2/c1-10-3-2-4-12-15(10)18-17(27-12)19-16(23)13-7-11(9-26-13)8-21-6-5-14(20-21)22(24)25/h2-7,9H,8H2,1H3,(H,18,19,23) |
| InChIKey | UXPCIWLBMWJFCY-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.46 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|