C24H21F2N5O4 — CID 19497383
2-[4-(difluoromethyl)-3,6-dimethylpyrazolo[3,4-b]pyridin-1-yl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]acetamide (PubChem CID 19497383) has the molecular formula C24H21F2N5O4 and a molecular weight of 481.46 g/mol. Its IUPAC name is 2-[4-(difluoromethyl)-3,6-dimethylpyrazolo[3,4-b]pyridin-1-yl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]acetamide.
| Compound Name | 2-[4-(difluoromethyl)-3,6-dimethylpyrazolo[3,4-b]pyridin-1-yl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]acetamide |
|---|---|
| PubChem CID | 19497383 |
| Molecular Formula | C24H21F2N5O4 |
| Molecular Weight | 481.46 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | 2-[4-(difluoromethyl)-3,6-dimethylpyrazolo[3,4-b]pyridin-1-yl]-N-[3-(3-methylphenoxy)-5-nitrophenyl]acetamide |
| SMILES | Cc1cccc(Oc2cc(NC(=O)Cn3nc(C)c4c(C(F)F)cc(C)nc43)cc([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C24H21F2N5O4/c1-13-5-4-6-18(7-13)35-19-10-16(9-17(11-19)31(33)34)28-21(32)12-30-24-22(15(3)29-30)20(23(25)26)8-14(2)27-24/h4-11,23H,12H2,1-3H3,(H,28,32) |
| InChIKey | HJSDLIILHBIJTH-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.46 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|