C24H19ClF3N5O4 — CID 19503854
N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-[3,6-dimethyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]acetamide (PubChem CID 19503854) has the molecular formula C24H19ClF3N5O4 and a molecular weight of 533.89 g/mol. Its IUPAC name is N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-[3,6-dimethyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]acetamide.
| Compound Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-[3,6-dimethyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]acetamide |
|---|---|
| PubChem CID | 19503854 |
| Molecular Formula | C24H19ClF3N5O4 |
| Molecular Weight | 533.89 g/mol |
| Exact Mass | 533.11 |
| IUPAC Name | N-[3-(4-chloro-3-methylphenoxy)-5-nitrophenyl]-2-[3,6-dimethyl-4-(trifluoromethyl)pyrazolo[3,4-b]pyridin-1-yl]acetamide |
| SMILES | Cc1cc(C(F)(F)F)c2c(C)nn(CC(=O)Nc3cc(Oc4ccc(Cl)c(C)c4)cc([N+](=O)[O-])c3)c2n1 |
| InChI | InChI=1S/C24H19ClF3N5O4/c1-12-6-17(4-5-20(12)25)37-18-9-15(8-16(10-18)33(35)36)30-21(34)11-32-23-22(14(3)31-32)19(24(26,27)28)7-13(2)29-23/h4-10H,11H2,1-3H3,(H,30,34) |
| InChIKey | VGLMXUZDLDGBPJ-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.89 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|