C26H26N8O4 — CID 19497660
3,6-dicyclopropyl-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1-phenylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 19497660) has the molecular formula C26H26N8O4 and a molecular weight of 514.55 g/mol. Its IUPAC name is 3,6-dicyclopropyl-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1-phenylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | 3,6-dicyclopropyl-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1-phenylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 19497660 |
| Molecular Formula | C26H26N8O4 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 3,6-dicyclopropyl-N-[2-[[2-(4-nitropyrazol-1-yl)acetyl]amino]ethyl]-1-phenylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | O=C(Cn1cc([N+](=O)[O-])cn1)NCCNC(=O)c1cc(C2CC2)nc2c1c(C1CC1)nn2-c1ccccc1 |
| InChI | InChI=1S/C26H26N8O4/c35-22(15-32-14-19(13-29-32)34(37)38)27-10-11-28-26(36)20-12-21(16-6-7-16)30-25-23(20)24(17-8-9-17)31-33(25)18-4-2-1-3-5-18/h1-5,12-14,16-17H,6-11,15H2,(H,27,35)(H,28,36) |
| InChIKey | FMKGNIRKTQLFCL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|