C23H26N6O2S — CID 19588443
1-[(3,6-dicyclopropyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-(2-methoxyethyl)thiourea (PubChem CID 19588443) has the molecular formula C23H26N6O2S and a molecular weight of 450.57 g/mol. Its IUPAC name is 1-[(3,6-dicyclopropyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-(2-methoxyethyl)thiourea.
| Compound Name | 1-[(3,6-dicyclopropyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-(2-methoxyethyl)thiourea |
|---|---|
| PubChem CID | 19588443 |
| Molecular Formula | C23H26N6O2S |
| Molecular Weight | 450.57 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 1-[(3,6-dicyclopropyl-1-phenylpyrazolo[5,4-b]pyridine-4-carbonyl)amino]-3-(2-methoxyethyl)thiourea |
| SMILES | COCCNC(=S)NNC(=O)c1cc(C2CC2)nc2c1c(C1CC1)nn2-c1ccccc1 |
| InChI | InChI=1S/C23H26N6O2S/c1-31-12-11-24-23(32)27-26-22(30)17-13-18(14-7-8-14)25-21-19(17)20(15-9-10-15)28-29(21)16-5-3-2-4-6-16/h2-6,13-15H,7-12H2,1H3,(H,26,30)(H2,24,27,32) |
| InChIKey | CIKIQFBIHMXELZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 93.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|