C13H11Cl2N3O3 — CID 19502903
2-[4-[(3,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 19502903) has the molecular formula C13H11Cl2N3O3 and a molecular weight of 328.16 g/mol. Its IUPAC name is 2-[4-[(3,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 2-[4-[(3,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 19502903 |
| Molecular Formula | C13H11Cl2N3O3 |
| Molecular Weight | 328.16 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 2-[4-[(3,4-dichlorophenyl)carbamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)n1cc(C(=O)Nc2ccc(Cl)c(Cl)c2)cn1 |
| InChI | InChI=1S/C13H11Cl2N3O3/c1-7(13(20)21)18-6-8(5-16-18)12(19)17-9-2-3-10(14)11(15)4-9/h2-7H,1H3,(H,17,19)(H,20,21) |
| InChIKey | SBUTWJGVHAMPAU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.16 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |