C17H22N4O3 — CID 19504874
1-[1-[4-(diethylamino)anilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid (PubChem CID 19504874) has the molecular formula C17H22N4O3 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-[1-[4-(diethylamino)anilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid.
| Compound Name | 1-[1-[4-(diethylamino)anilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 19504874 |
| Molecular Formula | C17H22N4O3 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 1-[1-[4-(diethylamino)anilino]-1-oxopropan-2-yl]pyrazole-4-carboxylic acid |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)n2cc(C(=O)O)cn2)cc1 |
| InChI | InChI=1S/C17H22N4O3/c1-4-20(5-2)15-8-6-14(7-9-15)19-16(22)12(3)21-11-13(10-18-21)17(23)24/h6-12H,4-5H2,1-3H3,(H,19,22)(H,23,24) |
| InChIKey | KDBGDVHFPJXCOA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|