C17H23ClN4O — CID 19570296
3-(4-chloropyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide (PubChem CID 19570296) has the molecular formula C17H23ClN4O and a molecular weight of 334.85 g/mol. Its IUPAC name is 3-(4-chloropyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide.
| Compound Name | 3-(4-chloropyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 19570296 |
| Molecular Formula | C17H23ClN4O |
| Molecular Weight | 334.85 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 3-(4-chloropyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)Cn2cc(Cl)cn2)cc1 |
| InChI | InChI=1S/C17H23ClN4O/c1-4-21(5-2)16-8-6-15(7-9-16)20-17(23)13(3)11-22-12-14(18)10-19-22/h6-10,12-13H,4-5,11H2,1-3H3,(H,20,23) |
| InChIKey | VEDVLVSZZAFJBE-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.85 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|