C19H27BrN4O — CID 19564213
3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide (PubChem CID 19564213) has the molecular formula C19H27BrN4O and a molecular weight of 407.36 g/mol. Its IUPAC name is 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide.
| Compound Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 19564213 |
| Molecular Formula | C19H27BrN4O |
| Molecular Weight | 407.36 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 3-(4-bromo-3,5-dimethylpyrazol-1-yl)-N-[4-(diethylamino)phenyl]-2-methylpropanamide |
| SMILES | CCN(CC)c1ccc(NC(=O)C(C)Cn2nc(C)c(Br)c2C)cc1 |
| InChI | InChI=1S/C19H27BrN4O/c1-6-23(7-2)17-10-8-16(9-11-17)21-19(25)13(3)12-24-15(5)18(20)14(4)22-24/h8-11,13H,6-7,12H2,1-5H3,(H,21,25) |
| InChIKey | BDIJJGGRXZLYMB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|