C12H10ClF2N3O — CID 19506728
N-(5-chloro-2-methylphenyl)-2-(difluoromethyl)pyrazole-3-carboxamide (PubChem CID 19506728) has the molecular formula C12H10ClF2N3O and a molecular weight of 285.68 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-(difluoromethyl)pyrazole-3-carboxamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-(difluoromethyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19506728 |
| Molecular Formula | C12H10ClF2N3O |
| Molecular Weight | 285.68 g/mol |
| Exact Mass | 285.05 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-(difluoromethyl)pyrazole-3-carboxamide |
| SMILES | Cc1ccc(Cl)cc1NC(=O)c1ccnn1C(F)F |
| InChI | InChI=1S/C12H10ClF2N3O/c1-7-2-3-8(13)6-9(7)17-11(19)10-4-5-16-18(10)12(14)15/h2-6,12H,1H3,(H,17,19) |
| InChIKey | UJXRKJMKSCUNGK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.68 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |