C11H6BrN5O3 — CID 19507747
4-bromo-N-(2-cyano-4-nitrophenyl)-1H-pyrazole-5-carboxamide (PubChem CID 19507747) has the molecular formula C11H6BrN5O3 and a molecular weight of 336.11 g/mol. Its IUPAC name is 4-bromo-N-(2-cyano-4-nitrophenyl)-1H-pyrazole-5-carboxamide.
| Compound Name | 4-bromo-N-(2-cyano-4-nitrophenyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19507747 |
| Molecular Formula | C11H6BrN5O3 |
| Molecular Weight | 336.11 g/mol |
| Exact Mass | 334.97 |
| IUPAC Name | 4-bromo-N-(2-cyano-4-nitrophenyl)-1H-pyrazole-5-carboxamide |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1NC(=O)c1[nH]ncc1Br |
| InChI | InChI=1S/C11H6BrN5O3/c12-8-5-14-16-10(8)11(18)15-9-2-1-7(17(19)20)3-6(9)4-13/h1-3,5H,(H,14,16)(H,15,18) |
| InChIKey | NZEAPQGMTLPKQA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 124.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|