C11H9Br2N3O2 — CID 19508436
4,5-dibromo-N-(3-methoxyphenyl)-1H-pyrazole-3-carboxamide (PubChem CID 19508436) has the molecular formula C11H9Br2N3O2 and a molecular weight of 375.02 g/mol. Its IUPAC name is 4,5-dibromo-N-(3-methoxyphenyl)-1H-pyrazole-3-carboxamide.
| Compound Name | 4,5-dibromo-N-(3-methoxyphenyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19508436 |
| Molecular Formula | C11H9Br2N3O2 |
| Molecular Weight | 375.02 g/mol |
| Exact Mass | 372.91 |
| IUPAC Name | 4,5-dibromo-N-(3-methoxyphenyl)-1H-pyrazole-3-carboxamide |
| SMILES | COc1cccc(NC(=O)c2n[nH]c(Br)c2Br)c1 |
| InChI | InChI=1S/C11H9Br2N3O2/c1-18-7-4-2-3-6(5-7)14-11(17)9-8(12)10(13)16-15-9/h2-5H,1H3,(H,14,17)(H,15,16) |
| InChIKey | QNKVPIGZBKDHBT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.02 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |