C18H14ClN5OS — CID 19509183
N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide (PubChem CID 19509183) has the molecular formula C18H14ClN5OS and a molecular weight of 383.86 g/mol. Its IUPAC name is N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide.
| Compound Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19509183 |
| Molecular Formula | C18H14ClN5OS |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[1-[(3-chlorophenyl)methyl]pyrazol-4-yl]-5-thiophen-2-yl-1H-pyrazole-3-carboxamide |
| SMILES | O=C(Nc1cnn(Cc2cccc(Cl)c2)c1)c1cc(-c2cccs2)[nH]n1 |
| InChI | InChI=1S/C18H14ClN5OS/c19-13-4-1-3-12(7-13)10-24-11-14(9-20-24)21-18(25)16-8-15(22-23-16)17-5-2-6-26-17/h1-9,11H,10H2,(H,21,25)(H,22,23) |
| InChIKey | KLBFSVDWXHHAOC-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |