C14H19N7O4 — CID 19514841
(3-methoxy-4-nitro-1H-pyrazol-5-yl)-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 19514841) has the molecular formula C14H19N7O4 and a molecular weight of 349.35 g/mol. Its IUPAC name is (3-methoxy-4-nitro-1H-pyrazol-5-yl)-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-methoxy-4-nitro-1H-pyrazol-5-yl)-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19514841 |
| Molecular Formula | C14H19N7O4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | (3-methoxy-4-nitro-1H-pyrazol-5-yl)-[4-[(1-methylpyrazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | COc1n[nH]c(C(=O)N2CCN(Cc3cnn(C)c3)CC2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N7O4/c1-18-8-10(7-15-18)9-19-3-5-20(6-4-19)14(22)11-12(21(23)24)13(25-2)17-16-11/h7-8H,3-6,9H2,1-2H3,(H,16,17) |
| InChIKey | LPBLKFOVTWFWJD-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 122.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|