C15H16ClF2N3O — CID 19517437
2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-(1-phenylethyl)acetamide (PubChem CID 19517437) has the molecular formula C15H16ClF2N3O and a molecular weight of 327.76 g/mol. Its IUPAC name is 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-(1-phenylethyl)acetamide.
| Compound Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-(1-phenylethyl)acetamide |
|---|---|
| PubChem CID | 19517437 |
| Molecular Formula | C15H16ClF2N3O |
| Molecular Weight | 327.76 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 2-[4-chloro-3-(difluoromethyl)-5-methylpyrazol-1-yl]-N-(1-phenylethyl)acetamide |
| SMILES | Cc1c(Cl)c(C(F)F)nn1CC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C15H16ClF2N3O/c1-9(11-6-4-3-5-7-11)19-12(22)8-21-10(2)13(16)14(20-21)15(17)18/h3-7,9,15H,8H2,1-2H3,(H,19,22) |
| InChIKey | WRWJYGHOQGQABV-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |