C15H15BrF3N3O — CID 1080175
2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide (PubChem CID 1080175) has the molecular formula C15H15BrF3N3O and a molecular weight of 390.20 g/mol. Its IUPAC name is 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide.
| Compound Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 1080175 |
| Molecular Formula | C15H15BrF3N3O |
| Molecular Weight | 390.20 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[(1R)-1-phenylethyl]acetamide |
| SMILES | Cc1c(Br)c(C(F)(F)F)nn1CC(=O)N[C@H](C)c1ccccc1 |
| InChI | InChI=1S/C15H15BrF3N3O/c1-9(11-6-4-3-5-7-11)20-12(23)8-22-10(2)13(16)14(21-22)15(17,18)19/h3-7,9H,8H2,1-2H3,(H,20,23)/t9-/m1/s1 |
| InChIKey | NWKGZJKQFYZPLF-SECBINFHSA-N |
| XLogP | 3.85 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.20 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |