C17H20BrF3N4O — CID 19523000
2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[4-(diethylamino)phenyl]acetamide (PubChem CID 19523000) has the molecular formula C17H20BrF3N4O and a molecular weight of 433.27 g/mol. Its IUPAC name is 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[4-(diethylamino)phenyl]acetamide.
| Compound Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[4-(diethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 19523000 |
| Molecular Formula | C17H20BrF3N4O |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 2-[4-bromo-5-methyl-3-(trifluoromethyl)pyrazol-1-yl]-N-[4-(diethylamino)phenyl]acetamide |
| SMILES | CCN(CC)c1ccc(NC(=O)Cn2nc(C(F)(F)F)c(Br)c2C)cc1 |
| InChI | InChI=1S/C17H20BrF3N4O/c1-4-24(5-2)13-8-6-12(7-9-13)22-14(26)10-25-11(3)15(18)16(23-25)17(19,20)21/h6-9H,4-5,10H2,1-3H3,(H,22,26) |
| InChIKey | CBYJKADVAWQJJU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|