C16H13BrF3N5O5 — CID 19519819
2-[4-bromo-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide (PubChem CID 19519819) has the molecular formula C16H13BrF3N5O5 and a molecular weight of 492.21 g/mol. Its IUPAC name is 2-[4-bromo-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide.
| Compound Name | 2-[4-bromo-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide |
|---|---|
| PubChem CID | 19519819 |
| Molecular Formula | C16H13BrF3N5O5 |
| Molecular Weight | 492.21 g/mol |
| Exact Mass | 491.01 |
| IUPAC Name | 2-[4-bromo-5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]-N-(4-methyl-3,5-dinitrophenyl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])cc(NC(=O)Cn2nc(C(F)(F)F)c(Br)c2C2CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H13BrF3N5O5/c1-7-10(24(27)28)4-9(5-11(7)25(29)30)21-12(26)6-23-14(8-2-3-8)13(17)15(22-23)16(18,19)20/h4-5,8H,2-3,6H2,1H3,(H,21,26) |
| InChIKey | JZAAZOWBTUNUFR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 133.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.21 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|