C14H15F2N3O2 — CID 19520335
2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide (PubChem CID 19520335) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 19520335 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-(furan-2-ylmethyl)acetamide |
| SMILES | O=C(Cn1nc(C(F)F)cc1C1CC1)NCc1ccco1 |
| InChI | InChI=1S/C14H15F2N3O2/c15-14(16)11-6-12(9-3-4-9)19(18-11)8-13(20)17-7-10-2-1-5-21-10/h1-2,5-6,9,14H,3-4,7-8H2,(H,17,20) |
| InChIKey | PFIMQBTUKQWYAZ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |