C20H27F2N3O — CID 19520381
N-(1-adamantylmethyl)-2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetamide (PubChem CID 19520381) has the molecular formula C20H27F2N3O and a molecular weight of 363.45 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetamide.
| Compound Name | N-(1-adamantylmethyl)-2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 19520381 |
| Molecular Formula | C20H27F2N3O |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-(1-adamantylmethyl)-2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]acetamide |
| SMILES | O=C(Cn1nc(C(F)F)cc1C1CC1)NCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H27F2N3O/c21-19(22)16-6-17(15-1-2-15)25(24-16)10-18(26)23-11-20-7-12-3-13(8-20)5-14(4-12)9-20/h6,12-15,19H,1-5,7-11H2,(H,23,26) |
| InChIKey | FUIGHLIOWRVEHR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |