C18H24F3N3O — CID 5004965
N-[2-(cyclohexen-1-yl)ethyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide (PubChem CID 5004965) has the molecular formula C18H24F3N3O and a molecular weight of 355.40 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
|---|---|
| PubChem CID | 5004965 |
| Molecular Formula | C18H24F3N3O |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-3-[5-cyclopropyl-3-(trifluoromethyl)pyrazol-1-yl]propanamide |
| SMILES | O=C(CCn1nc(C(F)(F)F)cc1C1CC1)NCCC1=CCCCC1 |
| InChI | InChI=1S/C18H24F3N3O/c19-18(20,21)16-12-15(14-6-7-14)24(23-16)11-9-17(25)22-10-8-13-4-2-1-3-5-13/h4,12,14H,1-3,5-11H2,(H,22,25) |
| InChIKey | RPLNDESMWCVJHV-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|