C15H11ClN4O5S — CID 19521694
methyl 3-chloro-6-[[2-(3-nitropyrazol-1-yl)acetyl]amino]-1-benzothiophene-2-carboxylate (PubChem CID 19521694) has the molecular formula C15H11ClN4O5S and a molecular weight of 394.80 g/mol. Its IUPAC name is methyl 3-chloro-6-[[2-(3-nitropyrazol-1-yl)acetyl]amino]-1-benzothiophene-2-carboxylate.
| Compound Name | methyl 3-chloro-6-[[2-(3-nitropyrazol-1-yl)acetyl]amino]-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19521694 |
| Molecular Formula | C15H11ClN4O5S |
| Molecular Weight | 394.80 g/mol |
| Exact Mass | 394.01 |
| IUPAC Name | methyl 3-chloro-6-[[2-(3-nitropyrazol-1-yl)acetyl]amino]-1-benzothiophene-2-carboxylate |
| SMILES | COC(=O)c1sc2cc(NC(=O)Cn3ccc([N+](=O)[O-])n3)ccc2c1Cl |
| InChI | InChI=1S/C15H11ClN4O5S/c1-25-15(22)14-13(16)9-3-2-8(6-10(9)26-14)17-12(21)7-19-5-4-11(18-19)20(23)24/h2-6H,7H2,1H3,(H,17,21) |
| InChIKey | NXIHKTVYZQWPNI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.80 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|