C11H12N6O5 — CID 19341551
methyl 1-methyl-4-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxylate (PubChem CID 19341551) has the molecular formula C11H12N6O5 and a molecular weight of 308.25 g/mol. Its IUPAC name is methyl 1-methyl-4-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxylate.
| Compound Name | methyl 1-methyl-4-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 19341551 |
| Molecular Formula | C11H12N6O5 |
| Molecular Weight | 308.25 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | methyl 1-methyl-4-[[2-(3-nitropyrazol-1-yl)acetyl]amino]pyrazole-3-carboxylate |
| SMILES | COC(=O)c1nn(C)cc1NC(=O)Cn1ccc([N+](=O)[O-])n1 |
| InChI | InChI=1S/C11H12N6O5/c1-15-5-7(10(14-15)11(19)22-2)12-9(18)6-16-4-3-8(13-16)17(20)21/h3-5H,6H2,1-2H3,(H,12,18) |
| InChIKey | VSGNGAMTPSKVLD-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 134.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.25 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|