C13H17N7O4 — CID 19566036
1-ethyl-N-methyl-4-[3-(3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide (PubChem CID 19566036) has the molecular formula C13H17N7O4 and a molecular weight of 335.32 g/mol. Its IUPAC name is 1-ethyl-N-methyl-4-[3-(3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide.
| Compound Name | 1-ethyl-N-methyl-4-[3-(3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19566036 |
| Molecular Formula | C13H17N7O4 |
| Molecular Weight | 335.32 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 1-ethyl-N-methyl-4-[3-(3-nitropyrazol-1-yl)propanoylamino]pyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CCn2ccc([N+](=O)[O-])n2)c(C(=O)NC)n1 |
| InChI | InChI=1S/C13H17N7O4/c1-3-18-8-9(12(17-18)13(22)14-2)15-11(21)5-7-19-6-4-10(16-19)20(23)24/h4,6,8H,3,5,7H2,1-2H3,(H,14,22)(H,15,21) |
| InChIKey | KXTIDRFNGQCTLQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|