C14H19BrN6O2 — CID 4777173
4-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]-1-ethyl-N-methylpyrazole-3-carboxamide (PubChem CID 4777173) has the molecular formula C14H19BrN6O2 and a molecular weight of 383.25 g/mol. Its IUPAC name is 4-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]-1-ethyl-N-methylpyrazole-3-carboxamide.
| Compound Name | 4-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]-1-ethyl-N-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4777173 |
| Molecular Formula | C14H19BrN6O2 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | 4-[3-(4-bromo-3-methylpyrazol-1-yl)propanoylamino]-1-ethyl-N-methylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CCn2cc(Br)c(C)n2)c(C(=O)NC)n1 |
| InChI | InChI=1S/C14H19BrN6O2/c1-4-20-8-11(13(19-20)14(23)16-3)17-12(22)5-6-21-7-10(15)9(2)18-21/h7-8H,4-6H2,1-3H3,(H,16,23)(H,17,22) |
| InChIKey | WZMCQXJILPTTRG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |