C13H17ClN6O2 — CID 19575410
4-[3-(4-chloro-3-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxamide (PubChem CID 19575410) has the molecular formula C13H17ClN6O2 and a molecular weight of 324.77 g/mol. Its IUPAC name is 4-[3-(4-chloro-3-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-[3-(4-chloro-3-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19575410 |
| Molecular Formula | C13H17ClN6O2 |
| Molecular Weight | 324.77 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | 4-[3-(4-chloro-3-methylpyrazol-1-yl)propanoylamino]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCn1cc(NC(=O)CCn2cc(Cl)c(C)n2)c(C(N)=O)n1 |
| InChI | InChI=1S/C13H17ClN6O2/c1-3-19-7-10(12(18-19)13(15)22)16-11(21)4-5-20-6-9(14)8(2)17-20/h6-7H,3-5H2,1-2H3,(H2,15,22)(H,16,21) |
| InChIKey | RCNAMCLQTCCUGL-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.77 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |