C12H8F4N4O3 — CID 19565795
3-(3-nitropyrazol-1-yl)-N-(2,3,5,6-tetrafluorophenyl)propanamide (PubChem CID 19565795) has the molecular formula C12H8F4N4O3 and a molecular weight of 332.21 g/mol. Its IUPAC name is 3-(3-nitropyrazol-1-yl)-N-(2,3,5,6-tetrafluorophenyl)propanamide.
| Compound Name | 3-(3-nitropyrazol-1-yl)-N-(2,3,5,6-tetrafluorophenyl)propanamide |
|---|---|
| PubChem CID | 19565795 |
| Molecular Formula | C12H8F4N4O3 |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 332.05 |
| IUPAC Name | 3-(3-nitropyrazol-1-yl)-N-(2,3,5,6-tetrafluorophenyl)propanamide |
| SMILES | O=C(CCn1ccc([N+](=O)[O-])n1)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C12H8F4N4O3/c13-6-5-7(14)11(16)12(10(6)15)17-9(21)2-4-19-3-1-8(18-19)20(22)23/h1,3,5H,2,4H2,(H,17,21) |
| InChIKey | GRMNWMGGGMVJGM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|