C13H10F5N3O — CID 19555789
3-(3-methylpyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 19555789) has the molecular formula C13H10F5N3O and a molecular weight of 319.23 g/mol. Its IUPAC name is 3-(3-methylpyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | 3-(3-methylpyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 19555789 |
| Molecular Formula | C13H10F5N3O |
| Molecular Weight | 319.23 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-(3-methylpyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | Cc1ccn(CCC(=O)Nc2c(F)c(F)c(F)c(F)c2F)n1 |
| InChI | InChI=1S/C13H10F5N3O/c1-6-2-4-21(20-6)5-3-7(22)19-13-11(17)9(15)8(14)10(16)12(13)18/h2,4H,3,5H2,1H3,(H,19,22) |
| InChIKey | OQOGAAUEBDWYAS-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|