C15H13Cl2N7O3 — CID 19522588
N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19522588) has the molecular formula C15H13Cl2N7O3 and a molecular weight of 410.22 g/mol. Its IUPAC name is N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19522588 |
| Molecular Formula | C15H13Cl2N7O3 |
| Molecular Weight | 410.22 g/mol |
| Exact Mass | 409.05 |
| IUPAC Name | N-[1-[(2,4-dichlorophenyl)methyl]-1,2,4-triazol-3-yl]-2-(5-methyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])cnn1CC(=O)Nc1ncn(Cc2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C15H13Cl2N7O3/c1-9-13(24(26)27)5-19-23(9)7-14(25)20-15-18-8-22(21-15)6-10-2-3-11(16)4-12(10)17/h2-5,8H,6-7H2,1H3,(H,20,21,25) |
| InChIKey | PSPFXAYHYPETCJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.22 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|