C18H19N7O5 — CID 19528369
N-[3-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 19528369) has the molecular formula C18H19N7O5 and a molecular weight of 413.39 g/mol. Its IUPAC name is N-[3-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19528369 |
| Molecular Formula | C18H19N7O5 |
| Molecular Weight | 413.39 g/mol |
| Exact Mass | 413.14 |
| IUPAC Name | N-[3-[2-(3-methoxy-4-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | COc1nn(C(C)C(=O)Nc2cccc(NC(=O)c3ccn(C)n3)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N7O5/c1-11(24-10-15(25(28)29)18(22-24)30-3)16(26)19-12-5-4-6-13(9-12)20-17(27)14-7-8-23(2)21-14/h4-11H,1-3H3,(H,19,26)(H,20,27) |
| InChIKey | CVFGGRHDZJMUNJ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 146.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|