C17H16BrN7O4 — CID 19567929
N-[3-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide (PubChem CID 19567929) has the molecular formula C17H16BrN7O4 and a molecular weight of 462.26 g/mol. Its IUPAC name is N-[3-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide.
| Compound Name | N-[3-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19567929 |
| Molecular Formula | C17H16BrN7O4 |
| Molecular Weight | 462.26 g/mol |
| Exact Mass | 461.04 |
| IUPAC Name | N-[3-[3-(4-bromo-3-nitropyrazol-1-yl)propanoylamino]phenyl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cn1ccc(C(=O)Nc2cccc(NC(=O)CCn3cc(Br)c([N+](=O)[O-])n3)c2)n1 |
| InChI | InChI=1S/C17H16BrN7O4/c1-23-7-5-14(21-23)17(27)20-12-4-2-3-11(9-12)19-15(26)6-8-24-10-13(18)16(22-24)25(28)29/h2-5,7,9-10H,6,8H2,1H3,(H,19,26)(H,20,27) |
| InChIKey | YOIYIBYWPVOVOH-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 136.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|