C12H7F5N4O3 — CID 19528793
2-(4-nitropyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 19528793) has the molecular formula C12H7F5N4O3 and a molecular weight of 350.20 g/mol. Its IUPAC name is 2-(4-nitropyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | 2-(4-nitropyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 19528793 |
| Molecular Formula | C12H7F5N4O3 |
| Molecular Weight | 350.20 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 2-(4-nitropyrazol-1-yl)-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | CC(C(=O)Nc1c(F)c(F)c(F)c(F)c1F)n1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C12H7F5N4O3/c1-4(20-3-5(2-18-20)21(23)24)12(22)19-11-9(16)7(14)6(13)8(15)10(11)17/h2-4H,1H3,(H,19,22) |
| InChIKey | RHOIFXMYIWVJSI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.20 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|