C14H10F7N3O — CID 19534423
2-(4-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide (PubChem CID 19534423) has the molecular formula C14H10F7N3O and a molecular weight of 369.24 g/mol. Its IUPAC name is 2-(4-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide.
| Compound Name | 2-(4-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
|---|---|
| PubChem CID | 19534423 |
| Molecular Formula | C14H10F7N3O |
| Molecular Weight | 369.24 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-(4-methylpyrazol-1-yl)-N-[2,3,5,6-tetrafluoro-4-(trifluoromethyl)phenyl]propanamide |
| SMILES | Cc1cnn(C(C)C(=O)Nc2c(F)c(F)c(C(F)(F)F)c(F)c2F)c1 |
| InChI | InChI=1S/C14H10F7N3O/c1-5-3-22-24(4-5)6(2)13(25)23-12-10(17)8(15)7(14(19,20)21)9(16)11(12)18/h3-4,6H,1-2H3,(H,23,25) |
| InChIKey | QXEVQSQGFWWJDS-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.24 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|