C17H13F5N6O4S — CID 19529109
3-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-4-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19529109) has the molecular formula C17H13F5N6O4S and a molecular weight of 492.39 g/mol. Its IUPAC name is 3-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-4-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-4-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19529109 |
| Molecular Formula | C17H13F5N6O4S |
| Molecular Weight | 492.39 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | 3-[[2-[3-(difluoromethyl)-5-methyl-4-nitropyrazol-1-yl]acetyl]amino]-4-methyl-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1cc(C(F)(F)F)nc2sc(C(N)=O)c(NC(=O)Cn3nc(C(F)F)c([N+](=O)[O-])c3C)c12 |
| InChI | InChI=1S/C17H13F5N6O4S/c1-5-3-7(17(20,21)22)24-16-9(5)10(13(33-16)15(23)30)25-8(29)4-27-6(2)12(28(31)32)11(26-27)14(18)19/h3,14H,4H2,1-2H3,(H2,23,30)(H,25,29) |
| InChIKey | KIFGLWDTQGBDSI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.39 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|