C16H12N8O5 — CID 19530055
N-(4-cyano-1-phenylpyrazol-5-yl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19530055) has the molecular formula C16H12N8O5 and a molecular weight of 396.32 g/mol. Its IUPAC name is N-(4-cyano-1-phenylpyrazol-5-yl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-(4-cyano-1-phenylpyrazol-5-yl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19530055 |
| Molecular Formula | C16H12N8O5 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | N-(4-cyano-1-phenylpyrazol-5-yl)-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)Nc1c(C#N)cnn1-c1ccccc1 |
| InChI | InChI=1S/C16H12N8O5/c1-10-14(23(26)27)16(24(28)29)20-21(10)9-13(25)19-15-11(7-17)8-18-22(15)12-5-3-2-4-6-12/h2-6,8H,9H2,1H3,(H,19,25) |
| InChIKey | DANOZINZXYNOTN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 174.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|